C28H49F3O4Si2 — CID 71762550
(1R,2R,3E,7R,11E,13S,15S)-2,15-bis[[tert-butyl(dimethyl)silyl]oxy]-7-(trifluoromethyl)-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one (PubChem CID 71762550) has the molecular formula C28H49F3O4Si2 and a molecular weight of 562.86 g/mol. Its IUPAC name is (1R,2R,3E,7R,11E,13S,15S)-2,15-bis[[tert-butyl(dimethyl)silyl]oxy]-7-(trifluoromethyl)-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one.
| Compound Name | (1R,2R,3E,7R,11E,13S,15S)-2,15-bis[[tert-butyl(dimethyl)silyl]oxy]-7-(trifluoromethyl)-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one |
|---|---|
| PubChem CID | 71762550 |
| Molecular Formula | C28H49F3O4Si2 |
| Molecular Weight | 562.86 g/mol |
| Exact Mass | 562.31 |
| IUPAC Name | (1R,2R,3E,7R,11E,13S,15S)-2,15-bis[[tert-butyl(dimethyl)silyl]oxy]-7-(trifluoromethyl)-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H]2[C@H](/C=C/CCC[C@H](C(F)(F)F)OC(=O)/C=C/[C@H]2O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C28H49F3O4Si2/c1-26(2,3)36(7,8)34-21-18-20-14-12-11-13-15-24(28(29,30)31)33-25(32)17-16-23(22(20)19-21)35-37(9,10)27(4,5)6/h12,14,16-17,20-24H,11,13,15,18-19H2,1-10H3/b14-12+,17-16+/t20-,21+,22-,23-,24-/m1/s1 |
| InChIKey | AZNSNHHWIRCYSZ-FCRIWQKASA-N |
| XLogP | 8.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.86 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|