C23H46O5Si2 — CID 10917502
methyl (E)-4-[(1S,2S,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclopentyl]but-2-enoate (PubChem CID 10917502) has the molecular formula C23H46O5Si2 and a molecular weight of 458.79 g/mol. Its IUPAC name is methyl (E)-4-[(1S,2S,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclopentyl]but-2-enoate.
| Compound Name | methyl (E)-4-[(1S,2S,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclopentyl]but-2-enoate |
|---|---|
| PubChem CID | 10917502 |
| Molecular Formula | C23H46O5Si2 |
| Molecular Weight | 458.79 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | methyl (E)-4-[(1S,2S,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclopentyl]but-2-enoate |
| SMILES | COC(=O)/C=C/C[C@H]1[C@@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H46O5Si2/c1-22(2,3)29(8,9)27-19-15-20(28-30(10,11)23(4,5)6)18(16-24)17(19)13-12-14-21(25)26-7/h12,14,17-20,24H,13,15-16H2,1-11H3/b14-12+/t17-,18+,19-,20+/m0/s1 |
| InChIKey | AFAJLLMBDOFTNS-QPTMEINESA-N |
| XLogP | 5.51 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.79 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|