C18H28O4 — CID 71818670
[(2S)-hex-5-en-2-yl] 2-[(2R,3S,6R)-3-ethoxy-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]acetate (PubChem CID 71818670) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is [(2S)-hex-5-en-2-yl] 2-[(2R,3S,6R)-3-ethoxy-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]acetate.
| Compound Name | [(2S)-hex-5-en-2-yl] 2-[(2R,3S,6R)-3-ethoxy-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]acetate |
|---|---|
| PubChem CID | 71818670 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | [(2S)-hex-5-en-2-yl] 2-[(2R,3S,6R)-3-ethoxy-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]acetate |
| SMILES | C=CCC[C@H](C)OC(=O)C[C@H]1O[C@H](CC=C)C=C[C@@H]1OCC |
| InChI | InChI=1S/C18H28O4/c1-5-8-10-14(4)21-18(19)13-17-16(20-7-3)12-11-15(22-17)9-6-2/h5-6,11-12,14-17H,1-2,7-10,13H2,3-4H3/t14-,15+,16-,17+/m0/s1 |
| InChIKey | RNLOVUQWAMQGJB-VVLHAWIVSA-N |
| XLogP | 3.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|