C20H16FN7O5 — CID 71961815
7-[(4-fluorophenyl)methyl]-3-methyl-8-[2-[3-(5-nitrofuran-2-yl)prop-2-enylidene]hydrazinyl]purine-2,6-dione (PubChem CID 71961815) has the molecular formula C20H16FN7O5 and a molecular weight of 453.39 g/mol. Its IUPAC name is 7-[(4-fluorophenyl)methyl]-3-methyl-8-[2-[3-(5-nitrofuran-2-yl)prop-2-enylidene]hydrazinyl]purine-2,6-dione.
| Compound Name | 7-[(4-fluorophenyl)methyl]-3-methyl-8-[2-[3-(5-nitrofuran-2-yl)prop-2-enylidene]hydrazinyl]purine-2,6-dione |
|---|---|
| PubChem CID | 71961815 |
| Molecular Formula | C20H16FN7O5 |
| Molecular Weight | 453.39 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 7-[(4-fluorophenyl)methyl]-3-methyl-8-[2-[3-(5-nitrofuran-2-yl)prop-2-enylidene]hydrazinyl]purine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(NN=CC=Cc1ccc([N+](=O)[O-])o1)n2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C20H16FN7O5/c1-26-17-16(18(29)24-20(26)30)27(11-12-4-6-13(21)7-5-12)19(23-17)25-22-10-2-3-14-8-9-15(33-14)28(31)32/h2-10H,11H2,1H3,(H,23,25)(H,24,29,30) |
| InChIKey | LRTLSUWRDWRKBH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 153.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|