C34H30ClN3O4 — CID 72514026
3-chloro-N-[[4-[2-[ethyl-[1-(furan-2-yl)-2-phenylethyl]amino]-2-oxoethyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 72514026) has the molecular formula C34H30ClN3O4 and a molecular weight of 580.08 g/mol. Its IUPAC name is 3-chloro-N-[[4-[2-[ethyl-[1-(furan-2-yl)-2-phenylethyl]amino]-2-oxoethyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[[4-[2-[ethyl-[1-(furan-2-yl)-2-phenylethyl]amino]-2-oxoethyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 72514026 |
| Molecular Formula | C34H30ClN3O4 |
| Molecular Weight | 580.08 g/mol |
| Exact Mass | 579.19 |
| IUPAC Name | 3-chloro-N-[[4-[2-[ethyl-[1-(furan-2-yl)-2-phenylethyl]amino]-2-oxoethyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | CCN(C(=O)Cc1ccc(C=NNC(=O)c2ccc(O)c(Cl)c2)c2ccccc12)C(Cc1ccccc1)c1ccco1 |
| InChI | InChI=1S/C34H30ClN3O4/c1-2-38(30(32-13-8-18-42-32)19-23-9-4-3-5-10-23)33(40)21-24-14-15-26(28-12-7-6-11-27(24)28)22-36-37-34(41)25-16-17-31(39)29(35)20-25/h3-18,20,22,30,39H,2,19,21H2,1H3,(H,37,41) |
| InChIKey | DNNMXEKWFZVIKK-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.08 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|