C29H27FN6O3S2 — CID 72550067
[(4aR)-1-(4-fluorophenyl)-6-[(6-pyrrolidin-1-yl-3-pyridinyl)sulfonyl]-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone (PubChem CID 72550067) has the molecular formula C29H27FN6O3S2 and a molecular weight of 590.71 g/mol. Its IUPAC name is [(4aR)-1-(4-fluorophenyl)-6-[(6-pyrrolidin-1-yl-3-pyridinyl)sulfonyl]-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone.
| Compound Name | [(4aR)-1-(4-fluorophenyl)-6-[(6-pyrrolidin-1-yl-3-pyridinyl)sulfonyl]-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone |
|---|---|
| PubChem CID | 72550067 |
| Molecular Formula | C29H27FN6O3S2 |
| Molecular Weight | 590.71 g/mol |
| Exact Mass | 590.16 |
| IUPAC Name | [(4aR)-1-(4-fluorophenyl)-6-[(6-pyrrolidin-1-yl-3-pyridinyl)sulfonyl]-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone |
| SMILES | O=C(c1nccs1)[C@]12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCN(S(=O)(=O)c1ccc(N3CCCC3)nc1)C2 |
| InChI | InChI=1S/C29H27FN6O3S2/c30-22-3-5-23(6-4-22)36-25-15-21-9-13-35(41(38,39)24-7-8-26(32-18-24)34-11-1-2-12-34)19-29(21,16-20(25)17-33-36)27(37)28-31-10-14-40-28/h3-8,10,14-15,17-18H,1-2,9,11-13,16,19H2/t29-/m0/s1 |
| InChIKey | OWYUNGNGXPLDDN-LJAQVGFWSA-N |
| XLogP | 4.37 |
| TPSA | 101.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.71 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |