C8H17N2O2+ — CID 7258526
2-(4-ethylpiperazine-1,4-diium-1-yl)acetate (PubChem CID 7258526) has the molecular formula C8H17N2O2+ and a molecular weight of 173.24 g/mol. Its IUPAC name is 2-(4-ethylpiperazine-1,4-diium-1-yl)acetate.
| Compound Name | 2-(4-ethylpiperazine-1,4-diium-1-yl)acetate |
|---|---|
| PubChem CID | 7258526 |
| Molecular Formula | C8H17N2O2+ |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.13 |
| IUPAC Name | 2-(4-ethylpiperazine-1,4-diium-1-yl)acetate |
| SMILES | CC[NH+]1CC[NH+](CC(=O)[O-])CC1 |
| InChI | InChI=1S/C8H16N2O2/c1-2-9-3-5-10(6-4-9)7-8(11)12/h2-7H2,1H3,(H,11,12)/p+1 |
| InChIKey | WUEHSFSWKSCHCK-UHFFFAOYSA-O |
| XLogP | -4.46 |
| TPSA | 49.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | -4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |