C23H33FN2 — CID 72640803
8-(1,8a-dihydronaphthalen-1-ylmethyl)-N-ethyl-6-fluorodeca-2,6-diene-1,10-diamine (PubChem CID 72640803) has the molecular formula C23H33FN2 and a molecular weight of 356.53 g/mol. Its IUPAC name is 8-(1,8a-dihydronaphthalen-1-ylmethyl)-N-ethyl-6-fluorodeca-2,6-diene-1,10-diamine.
| Compound Name | 8-(1,8a-dihydronaphthalen-1-ylmethyl)-N-ethyl-6-fluorodeca-2,6-diene-1,10-diamine |
|---|---|
| PubChem CID | 72640803 |
| Molecular Formula | C23H33FN2 |
| Molecular Weight | 356.53 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | 8-(1,8a-dihydronaphthalen-1-ylmethyl)-N-ethyl-6-fluorodeca-2,6-diene-1,10-diamine |
| SMILES | CCNCC=CCCC(F)=CC(CCN)CC1C=CC=C2C=CC=CC21 |
| InChI | InChI=1S/C23H33FN2/c1-2-26-16-7-3-4-12-22(24)18-19(14-15-25)17-21-11-8-10-20-9-5-6-13-23(20)21/h3,5-11,13,18-19,21,23,26H,2,4,12,14-17,25H2,1H3 |
| InChIKey | HWYFWRNYHBDZMN-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|