C21H22O7S2 — CID 72697101
[(2R,3S,3aR,6aS)-4-(benzenesulfonyl)-5-methyl-3-(4-methylphenyl)sulfonyl-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-2-yl]methanol (PubChem CID 72697101) has the molecular formula C21H22O7S2 and a molecular weight of 450.53 g/mol. Its IUPAC name is [(2R,3S,3aR,6aS)-4-(benzenesulfonyl)-5-methyl-3-(4-methylphenyl)sulfonyl-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-2-yl]methanol.
| Compound Name | [(2R,3S,3aR,6aS)-4-(benzenesulfonyl)-5-methyl-3-(4-methylphenyl)sulfonyl-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-2-yl]methanol |
|---|---|
| PubChem CID | 72697101 |
| Molecular Formula | C21H22O7S2 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | [(2R,3S,3aR,6aS)-4-(benzenesulfonyl)-5-methyl-3-(4-methylphenyl)sulfonyl-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-2-yl]methanol |
| SMILES | CC1=C(S(=O)(=O)c2ccccc2)[C@@H]2[C@H](O1)O[C@H](CO)[C@H]2S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H22O7S2/c1-13-8-10-16(11-9-13)30(25,26)20-17(12-22)28-21-18(20)19(14(2)27-21)29(23,24)15-6-4-3-5-7-15/h3-11,17-18,20-22H,12H2,1-2H3/t17-,18+,20-,21-/m1/s1 |
| InChIKey | NFLRKIPDJIOPJM-KOUHRCEDSA-N |
| XLogP | 2.21 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |