C21H20O6S2 — CID 72697239
(1S,2S,4R,6R)-9-(benzenesulfonyl)-8-methyl-2-(4-methylphenyl)sulfonyl-5,7-dioxatricyclo[4.3.0.02,4]non-8-ene (PubChem CID 72697239) has the molecular formula C21H20O6S2 and a molecular weight of 432.52 g/mol. Its IUPAC name is (1S,2S,4R,6R)-9-(benzenesulfonyl)-8-methyl-2-(4-methylphenyl)sulfonyl-5,7-dioxatricyclo[4.3.0.02,4]non-8-ene.
| Compound Name | (1S,2S,4R,6R)-9-(benzenesulfonyl)-8-methyl-2-(4-methylphenyl)sulfonyl-5,7-dioxatricyclo[4.3.0.02,4]non-8-ene |
|---|---|
| PubChem CID | 72697239 |
| Molecular Formula | C21H20O6S2 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | (1S,2S,4R,6R)-9-(benzenesulfonyl)-8-methyl-2-(4-methylphenyl)sulfonyl-5,7-dioxatricyclo[4.3.0.02,4]non-8-ene |
| SMILES | CC1=C(S(=O)(=O)c2ccccc2)[C@H]2[C@@H](O1)O[C@@H]1C[C@@]12S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H20O6S2/c1-13-8-10-16(11-9-13)29(24,25)21-12-17(21)27-20-18(21)19(14(2)26-20)28(22,23)15-6-4-3-5-7-15/h3-11,17-18,20H,12H2,1-2H3/t17-,18+,20+,21-/m1/s1 |
| InChIKey | AEONLPBKUNGHEG-YXYSEUPNSA-N |
| XLogP | 2.99 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |