C20H24O3 — CID 72701076
1-[4-cyclohexyl-5-[(2-hydroxyphenyl)methyl]-2-methylfuran-3-yl]ethanone (PubChem CID 72701076) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is 1-[4-cyclohexyl-5-[(2-hydroxyphenyl)methyl]-2-methylfuran-3-yl]ethanone.
| Compound Name | 1-[4-cyclohexyl-5-[(2-hydroxyphenyl)methyl]-2-methylfuran-3-yl]ethanone |
|---|---|
| PubChem CID | 72701076 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 1-[4-cyclohexyl-5-[(2-hydroxyphenyl)methyl]-2-methylfuran-3-yl]ethanone |
| SMILES | CC(=O)c1c(C)oc(Cc2ccccc2O)c1C1CCCCC1 |
| InChI | InChI=1S/C20H24O3/c1-13(21)19-14(2)23-18(12-16-10-6-7-11-17(16)22)20(19)15-8-4-3-5-9-15/h6-7,10-11,15,22H,3-5,8-9,12H2,1-2H3 |
| InChIKey | MCASIGRMOSBARJ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |