C13H22O5 — CID 72714037
tert-butyl (2S,3S)-3-[(4S)-1,3-dioxan-4-yl]-2-hydroxypent-4-enoate (PubChem CID 72714037) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is tert-butyl (2S,3S)-3-[(4S)-1,3-dioxan-4-yl]-2-hydroxypent-4-enoate.
| Compound Name | tert-butyl (2S,3S)-3-[(4S)-1,3-dioxan-4-yl]-2-hydroxypent-4-enoate |
|---|---|
| PubChem CID | 72714037 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | tert-butyl (2S,3S)-3-[(4S)-1,3-dioxan-4-yl]-2-hydroxypent-4-enoate |
| SMILES | C=C[C@H]([C@@H]1CCOCO1)[C@H](O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H22O5/c1-5-9(10-6-7-16-8-17-10)11(14)12(15)18-13(2,3)4/h5,9-11,14H,1,6-8H2,2-4H3/t9-,10+,11+/m1/s1 |
| InChIKey | HEFANRBWGKUSQV-VWYCJHECSA-N |
| XLogP | 1.25 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|