C17H30O5 — CID 72714039
tert-butyl (2S,3S)-3-[(4S)-2,2-diethyl-1,3-dioxan-4-yl]-2-hydroxypent-4-enoate (PubChem CID 72714039) has the molecular formula C17H30O5 and a molecular weight of 314.42 g/mol. Its IUPAC name is tert-butyl (2S,3S)-3-[(4S)-2,2-diethyl-1,3-dioxan-4-yl]-2-hydroxypent-4-enoate.
| Compound Name | tert-butyl (2S,3S)-3-[(4S)-2,2-diethyl-1,3-dioxan-4-yl]-2-hydroxypent-4-enoate |
|---|---|
| PubChem CID | 72714039 |
| Molecular Formula | C17H30O5 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | tert-butyl (2S,3S)-3-[(4S)-2,2-diethyl-1,3-dioxan-4-yl]-2-hydroxypent-4-enoate |
| SMILES | C=C[C@H]([C@@H]1CCOC(CC)(CC)O1)[C@H](O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H30O5/c1-7-12(14(18)15(19)22-16(4,5)6)13-10-11-20-17(8-2,9-3)21-13/h7,12-14,18H,1,8-11H2,2-6H3/t12-,13+,14+/m1/s1 |
| InChIKey | JNVRCJIZUSVRKZ-RDBSUJKOSA-N |
| XLogP | 2.81 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|