C19H13BrN4S2Se — CID 72723360
(E)-1-(4-bromophenyl)-N-[5-[(2-phenyl-1,3-selenazol-4-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]methanimine (PubChem CID 72723360) has the molecular formula C19H13BrN4S2Se and a molecular weight of 520.34 g/mol. Its IUPAC name is (E)-1-(4-bromophenyl)-N-[5-[(2-phenyl-1,3-selenazol-4-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]methanimine.
| Compound Name | (E)-1-(4-bromophenyl)-N-[5-[(2-phenyl-1,3-selenazol-4-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]methanimine |
|---|---|
| PubChem CID | 72723360 |
| Molecular Formula | C19H13BrN4S2Se |
| Molecular Weight | 520.34 g/mol |
| Exact Mass | 519.89 |
| IUPAC Name | (E)-1-(4-bromophenyl)-N-[5-[(2-phenyl-1,3-selenazol-4-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]methanimine |
| SMILES | Brc1ccc(/C=N/c2nnc(SCc3c[se]c(-c4ccccc4)n3)s2)cc1 |
| InChI | InChI=1S/C19H13BrN4S2Se/c20-15-8-6-13(7-9-15)10-21-18-23-24-19(26-18)25-11-16-12-27-17(22-16)14-4-2-1-3-5-14/h1-10,12H,11H2/b21-10+ |
| InChIKey | GGLLNSOJSBJVAL-UFFVCSGVSA-N |
| XLogP | 5.46 |
| TPSA | 51.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.34 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|