C19H20O7 — CID 72724374
(11R,15R)-2,4,9,17-tetramethoxy-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3(8),4,6,9-pentaen-13-one (PubChem CID 72724374) has the molecular formula C19H20O7 and a molecular weight of 360.36 g/mol. Its IUPAC name is (11R,15R)-2,4,9,17-tetramethoxy-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3(8),4,6,9-pentaen-13-one.
| Compound Name | (11R,15R)-2,4,9,17-tetramethoxy-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3(8),4,6,9-pentaen-13-one |
|---|---|
| PubChem CID | 72724374 |
| Molecular Formula | C19H20O7 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | (11R,15R)-2,4,9,17-tetramethoxy-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3(8),4,6,9-pentaen-13-one |
| SMILES | COc1c2c(c(OC)c3c(OC)cccc13)C(OC)O[C@@H]1CC(=O)O[C@H]21 |
| InChI | InChI=1S/C19H20O7/c1-21-10-7-5-6-9-13(10)18(23-3)15-14(16(9)22-2)17-11(8-12(20)26-17)25-19(15)24-4/h5-7,11,17,19H,8H2,1-4H3/t11-,17+,19?/m1/s1 |
| InChIKey | DNNIXGJCWYTYCE-HCUPATASSA-N |
| XLogP | 2.90 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |