C20H22O7 — CID 56590221
(11R,15R,17R)-2,4,5,9-tetramethoxy-17-methyl-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3(8),4,6,9-pentaen-13-one (PubChem CID 56590221) has the molecular formula C20H22O7 and a molecular weight of 374.39 g/mol. Its IUPAC name is (11R,15R,17R)-2,4,5,9-tetramethoxy-17-methyl-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3(8),4,6,9-pentaen-13-one.
| Compound Name | (11R,15R,17R)-2,4,5,9-tetramethoxy-17-methyl-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3(8),4,6,9-pentaen-13-one |
|---|---|
| PubChem CID | 56590221 |
| Molecular Formula | C20H22O7 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | (11R,15R,17R)-2,4,5,9-tetramethoxy-17-methyl-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3(8),4,6,9-pentaen-13-one |
| SMILES | COc1ccc2c(OC)c3c(c(OC)c2c1OC)[C@@H](C)O[C@@H]1CC(=O)O[C@H]31 |
| InChI | InChI=1S/C20H22O7/c1-9-14-16(19-12(26-9)8-13(21)27-19)17(23-3)10-6-7-11(22-2)18(24-4)15(10)20(14)25-5/h6-7,9,12,19H,8H2,1-5H3/t9-,12-,19+/m1/s1 |
| InChIKey | REMXYFUORROQDG-VVSLUIPWSA-N |
| XLogP | 3.32 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |