C18H20O7 — CID 154707005
(4R,5R)-4-hydroxy-5-(1,4,5,8-tetramethoxynaphthalen-2-yl)oxolan-2-one (PubChem CID 154707005) has the molecular formula C18H20O7 and a molecular weight of 348.35 g/mol. Its IUPAC name is (4R,5R)-4-hydroxy-5-(1,4,5,8-tetramethoxynaphthalen-2-yl)oxolan-2-one.
| Compound Name | (4R,5R)-4-hydroxy-5-(1,4,5,8-tetramethoxynaphthalen-2-yl)oxolan-2-one |
|---|---|
| PubChem CID | 154707005 |
| Molecular Formula | C18H20O7 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | (4R,5R)-4-hydroxy-5-(1,4,5,8-tetramethoxynaphthalen-2-yl)oxolan-2-one |
| SMILES | COc1ccc(OC)c2c(OC)c([C@H]3OC(=O)C[C@H]3O)cc(OC)c12 |
| InChI | InChI=1S/C18H20O7/c1-21-11-5-6-12(22-2)16-15(11)13(23-3)7-9(18(16)24-4)17-10(19)8-14(20)25-17/h5-7,10,17,19H,8H2,1-4H3/t10-,17-/m1/s1 |
| InChIKey | DLBWETHJMGDELZ-BMLIUANNSA-N |
| XLogP | 2.22 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |