C18H16O7 — CID 11013340
(11R,15R)-9-acetyl-8-hydroxy-3,6-dimethoxy-12,16-dioxatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8-pentaen-13-one (PubChem CID 11013340) has the molecular formula C18H16O7 and a molecular weight of 344.32 g/mol. Its IUPAC name is (11R,15R)-9-acetyl-8-hydroxy-3,6-dimethoxy-12,16-dioxatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8-pentaen-13-one.
| Compound Name | (11R,15R)-9-acetyl-8-hydroxy-3,6-dimethoxy-12,16-dioxatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8-pentaen-13-one |
|---|---|
| PubChem CID | 11013340 |
| Molecular Formula | C18H16O7 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | (11R,15R)-9-acetyl-8-hydroxy-3,6-dimethoxy-12,16-dioxatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8-pentaen-13-one |
| SMILES | COc1ccc(OC)c2c3c(c(C(C)=O)c(O)c12)[C@H]1OC(=O)C[C@H]1O3 |
| InChI | InChI=1S/C18H16O7/c1-7(19)12-15-17-10(6-11(20)25-17)24-18(15)14-9(23-3)5-4-8(22-2)13(14)16(12)21/h4-5,10,17,21H,6H2,1-3H3/t10-,17+/m1/s1 |
| InChIKey | YEHNWKCMMMIJOQ-QGHHPUGFSA-N |
| XLogP | 2.51 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_55_B(1)', 'substructure': 'N/A'} |
|---|