C30H39F10NO — CID 72734966
1-[4-[difluoro-[4-(4-pentylcyclohexyl)cyclohexyl]methoxy]phenyl]-3,3,4,4,5,5,6,6-octafluoroazepane (PubChem CID 72734966) has the molecular formula C30H39F10NO and a molecular weight of 619.63 g/mol. Its IUPAC name is 1-[4-[difluoro-[4-(4-pentylcyclohexyl)cyclohexyl]methoxy]phenyl]-3,3,4,4,5,5,6,6-octafluoroazepane.
| Compound Name | 1-[4-[difluoro-[4-(4-pentylcyclohexyl)cyclohexyl]methoxy]phenyl]-3,3,4,4,5,5,6,6-octafluoroazepane |
|---|---|
| PubChem CID | 72734966 |
| Molecular Formula | C30H39F10NO |
| Molecular Weight | 619.63 g/mol |
| Exact Mass | 619.29 |
| IUPAC Name | 1-[4-[difluoro-[4-(4-pentylcyclohexyl)cyclohexyl]methoxy]phenyl]-3,3,4,4,5,5,6,6-octafluoroazepane |
| SMILES | CCCCCC1CCC(C2CCC(C(F)(F)Oc3ccc(N4CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C4)cc3)CC2)CC1 |
| InChI | InChI=1S/C30H39F10NO/c1-2-3-4-5-20-6-8-21(9-7-20)22-10-12-23(13-11-22)28(35,36)42-25-16-14-24(15-17-25)41-18-26(31,32)29(37,38)30(39,40)27(33,34)19-41/h14-17,20-23H,2-13,18-19H2,1H3 |
| InChIKey | QVXYPGONVVJCNU-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.63 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|