C35H45F5O3 — CID 58942512
1-[4-[2-[4-[difluoro-[4-(4-pentylcyclohexyl)cyclohexyl]methoxy]phenyl]ethyl]-2-hydroxy-3-(trifluoromethyl)phenyl]ethanone (PubChem CID 58942512) has the molecular formula C35H45F5O3 and a molecular weight of 608.73 g/mol. Its IUPAC name is 1-[4-[2-[4-[difluoro-[4-(4-pentylcyclohexyl)cyclohexyl]methoxy]phenyl]ethyl]-2-hydroxy-3-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 1-[4-[2-[4-[difluoro-[4-(4-pentylcyclohexyl)cyclohexyl]methoxy]phenyl]ethyl]-2-hydroxy-3-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 58942512 |
| Molecular Formula | C35H45F5O3 |
| Molecular Weight | 608.73 g/mol |
| Exact Mass | 608.33 |
| IUPAC Name | 1-[4-[2-[4-[difluoro-[4-(4-pentylcyclohexyl)cyclohexyl]methoxy]phenyl]ethyl]-2-hydroxy-3-(trifluoromethyl)phenyl]ethanone |
| SMILES | CCCCCC1CCC(C2CCC(C(F)(F)Oc3ccc(CCc4ccc(C(C)=O)c(O)c4C(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C35H45F5O3/c1-3-4-5-6-24-7-12-26(13-8-24)27-15-18-29(19-16-27)35(39,40)43-30-20-10-25(11-21-30)9-14-28-17-22-31(23(2)41)33(42)32(28)34(36,37)38/h10-11,17,20-22,24,26-27,29,42H,3-9,12-16,18-19H2,1-2H3 |
| InChIKey | VCBTWHUAQWUYDX-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.73 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|