C20H19N5O2 — CID 72884539
5-[[5-phenyl-2-(2-phenylethyl)-1,2,4-triazol-3-yl]methyl]imidazolidine-2,4-dione (PubChem CID 72884539) has the molecular formula C20H19N5O2 and a molecular weight of 361.40 g/mol. Its IUPAC name is 5-[[5-phenyl-2-(2-phenylethyl)-1,2,4-triazol-3-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | 5-[[5-phenyl-2-(2-phenylethyl)-1,2,4-triazol-3-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 72884539 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 5-[[5-phenyl-2-(2-phenylethyl)-1,2,4-triazol-3-yl]methyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2nc(-c3ccccc3)nn2CCc2ccccc2)N1 |
| InChI | InChI=1S/C20H19N5O2/c26-19-16(21-20(27)23-19)13-17-22-18(15-9-5-2-6-10-15)24-25(17)12-11-14-7-3-1-4-8-14/h1-10,16H,11-13H2,(H2,21,23,26,27) |
| InChIKey | CKSAIBZZHMOERY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|