C25H33N2O3+ — CID 7304711
diethyl-[3-[5-methoxy-2-methyl-1-(3-methylphenyl)indole-3-carbonyl]oxypropyl]azanium (PubChem CID 7304711) has the molecular formula C25H33N2O3+ and a molecular weight of 409.55 g/mol. Its IUPAC name is diethyl-[3-[5-methoxy-2-methyl-1-(3-methylphenyl)indole-3-carbonyl]oxypropyl]azanium.
| Compound Name | diethyl-[3-[5-methoxy-2-methyl-1-(3-methylphenyl)indole-3-carbonyl]oxypropyl]azanium |
|---|---|
| PubChem CID | 7304711 |
| Molecular Formula | C25H33N2O3+ |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | diethyl-[3-[5-methoxy-2-methyl-1-(3-methylphenyl)indole-3-carbonyl]oxypropyl]azanium |
| SMILES | CC[NH+](CC)CCCOC(=O)c1c(C)n(-c2cccc(C)c2)c2ccc(OC)cc12 |
| InChI | InChI=1S/C25H32N2O3/c1-6-26(7-2)14-9-15-30-25(28)24-19(4)27(20-11-8-10-18(3)16-20)23-13-12-21(29-5)17-22(23)24/h8,10-13,16-17H,6-7,9,14-15H2,1-5H3/p+1 |
| InChIKey | BCQNGLHWYGJJHM-UHFFFAOYSA-O |
| XLogP | 3.73 |
| TPSA | 44.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|