C15H26NO3+ — CID 7317677
butyl-methyl-[(3,4,5-trimethoxyphenyl)methyl]azanium (PubChem CID 7317677) has the molecular formula C15H26NO3+ and a molecular weight of 268.38 g/mol. Its IUPAC name is butyl-methyl-[(3,4,5-trimethoxyphenyl)methyl]azanium.
| Compound Name | butyl-methyl-[(3,4,5-trimethoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 7317677 |
| Molecular Formula | C15H26NO3+ |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | butyl-methyl-[(3,4,5-trimethoxyphenyl)methyl]azanium |
| SMILES | CCCC[NH+](C)Cc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C15H25NO3/c1-6-7-8-16(2)11-12-9-13(17-3)15(19-5)14(10-12)18-4/h9-10H,6-8,11H2,1-5H3/p+1 |
| InChIKey | LXWFMMZBGPQRAS-UHFFFAOYSA-O |
| XLogP | 1.53 |
| TPSA | 32.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |