C9H16Cl3N2O2+ — CID 7322615
[(1S)-1-acetamido-2,2,2-trichloroethyl]-[[(2R)-oxolan-2-yl]methyl]azanium (PubChem CID 7322615) has the molecular formula C9H16Cl3N2O2+ and a molecular weight of 290.60 g/mol. Its IUPAC name is [(1S)-1-acetamido-2,2,2-trichloroethyl]-[[(2R)-oxolan-2-yl]methyl]azanium.
| Compound Name | [(1S)-1-acetamido-2,2,2-trichloroethyl]-[[(2R)-oxolan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 7322615 |
| Molecular Formula | C9H16Cl3N2O2+ |
| Molecular Weight | 290.60 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | [(1S)-1-acetamido-2,2,2-trichloroethyl]-[[(2R)-oxolan-2-yl]methyl]azanium |
| SMILES | CC(=O)N[C@@H]([NH2+]C[C@H]1CCCO1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H15Cl3N2O2/c1-6(15)14-8(9(10,11)12)13-5-7-3-2-4-16-7/h7-8,13H,2-5H2,1H3,(H,14,15)/p+1/t7-,8-/m1/s1 |
| InChIKey | MNIUCNWXARYSQW-HTQZYQBOSA-O |
| XLogP | 0.56 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.60 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|