C27H39NO2 — CID 73292064
ethyl (2Z,4E,8E)-2-(1-anilinoethylidene)-5,9,13-trimethyltetradeca-4,8,12-trienoate (PubChem CID 73292064) has the molecular formula C27H39NO2 and a molecular weight of 409.61 g/mol. Its IUPAC name is ethyl (2Z,4E,8E)-2-(1-anilinoethylidene)-5,9,13-trimethyltetradeca-4,8,12-trienoate.
| Compound Name | ethyl (2Z,4E,8E)-2-(1-anilinoethylidene)-5,9,13-trimethyltetradeca-4,8,12-trienoate |
|---|---|
| PubChem CID | 73292064 |
| Molecular Formula | C27H39NO2 |
| Molecular Weight | 409.61 g/mol |
| Exact Mass | 409.30 |
| IUPAC Name | ethyl (2Z,4E,8E)-2-(1-anilinoethylidene)-5,9,13-trimethyltetradeca-4,8,12-trienoate |
| SMILES | CCOC(=O)/C(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)=C(/C)Nc1ccccc1 |
| InChI | InChI=1S/C27H39NO2/c1-7-30-27(29)26(24(6)28-25-17-9-8-10-18-25)20-19-23(5)16-12-15-22(4)14-11-13-21(2)3/h8-10,13,15,17-19,28H,7,11-12,14,16,20H2,1-6H3/b22-15+,23-19+,26-24- |
| InChIKey | REDNPQPYPJJWDP-VBINNWHOSA-N |
| XLogP | 7.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.61 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|