C19H28O6 — CID 73357319
ethyl (Z)-3-[(1S,5R,8S,9R,11R,12R)-1,5,9-trimethyl-10,13,14,15-tetraoxatetracyclo[9.3.1.04,12.08,12]pentadecan-9-yl]prop-2-enoate (PubChem CID 73357319) has the molecular formula C19H28O6 and a molecular weight of 352.43 g/mol. Its IUPAC name is ethyl (Z)-3-[(1S,5R,8S,9R,11R,12R)-1,5,9-trimethyl-10,13,14,15-tetraoxatetracyclo[9.3.1.04,12.08,12]pentadecan-9-yl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-[(1S,5R,8S,9R,11R,12R)-1,5,9-trimethyl-10,13,14,15-tetraoxatetracyclo[9.3.1.04,12.08,12]pentadecan-9-yl]prop-2-enoate |
|---|---|
| PubChem CID | 73357319 |
| Molecular Formula | C19H28O6 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | ethyl (Z)-3-[(1S,5R,8S,9R,11R,12R)-1,5,9-trimethyl-10,13,14,15-tetraoxatetracyclo[9.3.1.04,12.08,12]pentadecan-9-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C\[C@@]1(C)O[C@@H]2O[C@]3(C)CCC4[C@H](C)CC[C@@H]1[C@]42OO3 |
| InChI | InChI=1S/C19H28O6/c1-5-21-15(20)9-10-17(3)14-7-6-12(2)13-8-11-18(4)23-16(22-17)19(13,14)25-24-18/h9-10,12-14,16H,5-8,11H2,1-4H3/b10-9-/t12-,13?,14+,16-,17-,18+,19-/m1/s1 |
| InChIKey | RQGMVCMEWCAMJB-MTOYCTGPSA-N |
| XLogP | 3.11 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|