C22H30F3NO7 — CID 134154250
[(1S,4S,5R,8S,11R,12R)-1,5,9-trimethyl-10,13,14,15-tetraoxatetracyclo[9.3.1.04,12.08,12]pentadecan-9-yl]methyl (2S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxylate (PubChem CID 134154250) has the molecular formula C22H30F3NO7 and a molecular weight of 477.48 g/mol. Its IUPAC name is [(1S,4S,5R,8S,11R,12R)-1,5,9-trimethyl-10,13,14,15-tetraoxatetracyclo[9.3.1.04,12.08,12]pentadecan-9-yl]methyl (2S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxylate.
| Compound Name | [(1S,4S,5R,8S,11R,12R)-1,5,9-trimethyl-10,13,14,15-tetraoxatetracyclo[9.3.1.04,12.08,12]pentadecan-9-yl]methyl (2S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 134154250 |
| Molecular Formula | C22H30F3NO7 |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | [(1S,4S,5R,8S,11R,12R)-1,5,9-trimethyl-10,13,14,15-tetraoxatetracyclo[9.3.1.04,12.08,12]pentadecan-9-yl]methyl (2S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxylate |
| SMILES | C[C@@H]1CC[C@H]2C(C)(COC(=O)[C@@H]3CCCN3C(=O)C(F)(F)F)O[C@@H]3O[C@]4(C)CC[C@@H]1[C@]32OO4 |
| InChI | InChI=1S/C22H30F3NO7/c1-12-6-7-15-19(2,30-18-21(15)13(12)8-9-20(3,31-18)32-33-21)11-29-16(27)14-5-4-10-26(14)17(28)22(23,24)25/h12-15,18H,4-11H2,1-3H3/t12-,13+,14+,15+,18-,19?,20+,21-/m1/s1 |
| InChIKey | UIIIUJNHCWXIMH-ALUGEVPNSA-N |
| XLogP | 3.09 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|