C24H35NO9 — CID 95796303
(2R)-1-[4-oxo-4-[[(1S,4S,5R,8S,9R,10S,12R,13S)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 95796303) has the molecular formula C24H35NO9 and a molecular weight of 481.54 g/mol. Its IUPAC name is (2R)-1-[4-oxo-4-[[(1S,4S,5R,8S,9R,10S,12R,13S)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[4-oxo-4-[[(1S,4S,5R,8S,9R,10S,12R,13S)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 95796303 |
| Molecular Formula | C24H35NO9 |
| Molecular Weight | 481.54 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | (2R)-1-[4-oxo-4-[[(1S,4S,5R,8S,9R,10S,12R,13S)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | C[C@H]1[C@H](OC(=O)CCC(=O)N2CCC[C@@H]2C(=O)O)O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@]24OO3 |
| InChI | InChI=1S/C24H35NO9/c1-13-6-7-16-14(2)21(31-22-24(16)15(13)10-11-23(3,32-22)33-34-24)30-19(27)9-8-18(26)25-12-4-5-17(25)20(28)29/h13-17,21-22H,4-12H2,1-3H3,(H,28,29)/t13-,14-,15+,16+,17-,21-,22-,23+,24+/m1/s1 |
| InChIKey | FGGBGVLIXGEXDO-KBWBSFQXSA-N |
| XLogP | 2.59 |
| TPSA | 120.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.54 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|