C25H32N3O3+ — CID 7344136
(4-benzylpiperidin-1-yl)-[(3S)-1-[(4-nitrophenyl)methyl]piperidin-1-ium-3-yl]methanone (PubChem CID 7344136) has the molecular formula C25H32N3O3+ and a molecular weight of 422.55 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-[(3S)-1-[(4-nitrophenyl)methyl]piperidin-1-ium-3-yl]methanone.
| Compound Name | (4-benzylpiperidin-1-yl)-[(3S)-1-[(4-nitrophenyl)methyl]piperidin-1-ium-3-yl]methanone |
|---|---|
| PubChem CID | 7344136 |
| Molecular Formula | C25H32N3O3+ |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-[(3S)-1-[(4-nitrophenyl)methyl]piperidin-1-ium-3-yl]methanone |
| SMILES | O=C([C@H]1CCC[NH+](Cc2ccc([N+](=O)[O-])cc2)C1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H31N3O3/c29-25(27-15-12-21(13-16-27)17-20-5-2-1-3-6-20)23-7-4-14-26(19-23)18-22-8-10-24(11-9-22)28(30)31/h1-3,5-6,8-11,21,23H,4,7,12-19H2/p+1/t23-/m0/s1 |
| InChIKey | GOLOTJHAPIHBRK-QHCPKHFHSA-O |
| XLogP | 2.87 |
| TPSA | 67.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|