C12H16N4O2S3 — CID 7361004
1-[(4S)-5,5-dimethyl-2-sulfanylidene-3-[(Z)-thiophen-2-ylmethylideneamino]-1,3-thiazolidin-4-yl]-1-hydroxy-3-methylurea (PubChem CID 7361004) has the molecular formula C12H16N4O2S3 and a molecular weight of 344.49 g/mol. Its IUPAC name is 1-[(4S)-5,5-dimethyl-2-sulfanylidene-3-[(Z)-thiophen-2-ylmethylideneamino]-1,3-thiazolidin-4-yl]-1-hydroxy-3-methylurea.
| Compound Name | 1-[(4S)-5,5-dimethyl-2-sulfanylidene-3-[(Z)-thiophen-2-ylmethylideneamino]-1,3-thiazolidin-4-yl]-1-hydroxy-3-methylurea |
|---|---|
| PubChem CID | 7361004 |
| Molecular Formula | C12H16N4O2S3 |
| Molecular Weight | 344.49 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 1-[(4S)-5,5-dimethyl-2-sulfanylidene-3-[(Z)-thiophen-2-ylmethylideneamino]-1,3-thiazolidin-4-yl]-1-hydroxy-3-methylurea |
| SMILES | CNC(=O)N(O)[C@@H]1N(/N=C\c2cccs2)C(=S)SC1(C)C |
| InChI | InChI=1S/C12H16N4O2S3/c1-12(2)9(16(18)10(17)13-3)15(11(19)21-12)14-7-8-5-4-6-20-8/h4-7,9,18H,1-3H3,(H,13,17)/b14-7-/t9-/m0/s1 |
| InChIKey | BJUPOYYZMDEACS-VUPJLDGMSA-N |
| XLogP | 2.55 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|