C18H28N7O3+ — CID 7388237
1-[(1S)-1-[1-(2-methoxyethyl)tetrazol-5-yl]-2-methylpropyl]-4-(4-nitrophenyl)piperazin-1-ium (PubChem CID 7388237) has the molecular formula C18H28N7O3+ and a molecular weight of 390.47 g/mol. Its IUPAC name is 1-[(1S)-1-[1-(2-methoxyethyl)tetrazol-5-yl]-2-methylpropyl]-4-(4-nitrophenyl)piperazin-1-ium.
| Compound Name | 1-[(1S)-1-[1-(2-methoxyethyl)tetrazol-5-yl]-2-methylpropyl]-4-(4-nitrophenyl)piperazin-1-ium |
|---|---|
| PubChem CID | 7388237 |
| Molecular Formula | C18H28N7O3+ |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 1-[(1S)-1-[1-(2-methoxyethyl)tetrazol-5-yl]-2-methylpropyl]-4-(4-nitrophenyl)piperazin-1-ium |
| SMILES | COCCn1nnnc1[C@H](C(C)C)[NH+]1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C18H27N7O3/c1-14(2)17(18-19-20-21-24(18)12-13-28-3)23-10-8-22(9-11-23)15-4-6-16(7-5-15)25(26)27/h4-7,14,17H,8-13H2,1-3H3/p+1/t17-/m0/s1 |
| InChIKey | VSZRKQVLTJTRRN-KRWDZBQOSA-O |
| XLogP | 0.33 |
| TPSA | 103.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|