C40H44O10 — CID 74025150
2-[3-methoxycarbonyl-5-[3-[6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]propoxy]phenoxy]acetic acid (PubChem CID 74025150) has the molecular formula C40H44O10 and a molecular weight of 684.78 g/mol. Its IUPAC name is 2-[3-methoxycarbonyl-5-[3-[6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]propoxy]phenoxy]acetic acid.
| Compound Name | 2-[3-methoxycarbonyl-5-[3-[6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]propoxy]phenoxy]acetic acid |
|---|---|
| PubChem CID | 74025150 |
| Molecular Formula | C40H44O10 |
| Molecular Weight | 684.78 g/mol |
| Exact Mass | 684.29 |
| IUPAC Name | 2-[3-methoxycarbonyl-5-[3-[6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]propoxy]phenoxy]acetic acid |
| SMILES | COC(=O)c1cc(OCCCC2OC(C)C(OCc3ccccc3)C(OCc3ccccc3)C2OCc2ccccc2)cc(OCC(=O)O)c1 |
| InChI | InChI=1S/C40H44O10/c1-28-37(47-24-29-13-6-3-7-14-29)39(49-26-31-17-10-5-11-18-31)38(48-25-30-15-8-4-9-16-30)35(50-28)19-12-20-45-33-21-32(40(43)44-2)22-34(23-33)46-27-36(41)42/h3-11,13-18,21-23,28,35,37-39H,12,19-20,24-27H2,1-2H3,(H,41,42) |
| InChIKey | XIZOFBFUKXBQTI-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.78 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|