C35H40N2O8 — CID 23651519
2-[[2-[[(E)-4-[(2R,3R,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]but-2-enoyl]amino]acetyl]amino]acetic acid (PubChem CID 23651519) has the molecular formula C35H40N2O8 and a molecular weight of 616.71 g/mol. Its IUPAC name is 2-[[2-[[(E)-4-[(2R,3R,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]but-2-enoyl]amino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[[(E)-4-[(2R,3R,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]but-2-enoyl]amino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 23651519 |
| Molecular Formula | C35H40N2O8 |
| Molecular Weight | 616.71 g/mol |
| Exact Mass | 616.28 |
| IUPAC Name | 2-[[2-[[(E)-4-[(2R,3R,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]but-2-enoyl]amino]acetyl]amino]acetic acid |
| SMILES | C[C@@H]1O[C@H](C/C=C/C(=O)NCC(=O)NCC(=O)O)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H40N2O8/c1-25-33(42-22-26-12-5-2-6-13-26)35(44-24-28-16-9-4-10-17-28)34(43-23-27-14-7-3-8-15-27)29(45-25)18-11-19-30(38)36-20-31(39)37-21-32(40)41/h2-17,19,25,29,33-35H,18,20-24H2,1H3,(H,36,38)(H,37,39)(H,40,41)/b19-11+/t25-,29+,33+,34+,35+/m0/s1 |
| InChIKey | IQAHEGBAZOHISY-ACFXGNDMSA-N |
| XLogP | 3.79 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.71 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|