C20H26F6O2 — CID 74058643
[1,1,1,3,3,3-hexafluoro-2-[(3-methyl-5-prop-1-enyl-8-tricyclo[5.2.1.02,6]decanyl)methyl]propan-2-yl] acetate (PubChem CID 74058643) has the molecular formula C20H26F6O2 and a molecular weight of 412.41 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-[(3-methyl-5-prop-1-enyl-8-tricyclo[5.2.1.02,6]decanyl)methyl]propan-2-yl] acetate.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-[(3-methyl-5-prop-1-enyl-8-tricyclo[5.2.1.02,6]decanyl)methyl]propan-2-yl] acetate |
|---|---|
| PubChem CID | 74058643 |
| Molecular Formula | C20H26F6O2 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-[(3-methyl-5-prop-1-enyl-8-tricyclo[5.2.1.02,6]decanyl)methyl]propan-2-yl] acetate |
| SMILES | CC=CC1CC(C)C2C3CC(CC(OC(C)=O)(C(F)(F)F)C(F)(F)F)C(C3)C12 |
| InChI | InChI=1S/C20H26F6O2/c1-4-5-12-6-10(2)16-13-7-14(15(8-13)17(12)16)9-18(19(21,22)23,20(24,25)26)28-11(3)27/h4-5,10,12-17H,6-9H2,1-3H3 |
| InChIKey | YGEAMVQACRIQHD-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|