C20H29N6O6P — CID 74083987
N-(1-adamantyl)-[[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]phosphonamidic acid (PubChem CID 74083987) has the molecular formula C20H29N6O6P and a molecular weight of 480.46 g/mol. Its IUPAC name is N-(1-adamantyl)-[[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]phosphonamidic acid.
| Compound Name | N-(1-adamantyl)-[[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]phosphonamidic acid |
|---|---|
| PubChem CID | 74083987 |
| Molecular Formula | C20H29N6O6P |
| Molecular Weight | 480.46 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | N-(1-adamantyl)-[[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]phosphonamidic acid |
| SMILES | Nc1ncnc2c1ncn2C1OC(COP(=O)(O)NC23CC4CC(CC(C4)C2)C3)C(O)C1O |
| InChI | InChI=1S/C20H29N6O6P/c21-17-14-18(23-8-22-17)26(9-24-14)19-16(28)15(27)13(32-19)7-31-33(29,30)25-20-4-10-1-11(5-20)3-12(2-10)6-20/h8-13,15-16,19,27-28H,1-7H2,(H2,21,22,23)(H2,25,29,30) |
| InChIKey | PKBMILHIRIKSPI-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 177.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.46 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|