C13H19N3O2 — CID 74663031
6-methyl-N-[(5-methylpyrazolidin-3-yl)methyl]-1,3-benzodioxol-5-amine (PubChem CID 74663031) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is 6-methyl-N-[(5-methylpyrazolidin-3-yl)methyl]-1,3-benzodioxol-5-amine.
| Compound Name | 6-methyl-N-[(5-methylpyrazolidin-3-yl)methyl]-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 74663031 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 6-methyl-N-[(5-methylpyrazolidin-3-yl)methyl]-1,3-benzodioxol-5-amine |
| SMILES | Cc1cc2c(cc1NCC1CC(C)NN1)OCO2 |
| InChI | InChI=1S/C13H19N3O2/c1-8-3-12-13(18-7-17-12)5-11(8)14-6-10-4-9(2)15-16-10/h3,5,9-10,14-16H,4,6-7H2,1-2H3 |
| InChIKey | RZHKTRCQZOJLCW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 54.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|