C11H26BN3O3 — CID 74765716
[(1R)-1-[[(2S)-2,6-diaminohexanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 74765716) has the molecular formula C11H26BN3O3 and a molecular weight of 259.16 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-2,6-diaminohexanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-2,6-diaminohexanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 74765716 |
| Molecular Formula | C11H26BN3O3 |
| Molecular Weight | 259.16 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | [(1R)-1-[[(2S)-2,6-diaminohexanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)CCCCN)B(O)O |
| InChI | InChI=1S/C11H26BN3O3/c1-8(2)7-10(12(17)18)15-11(16)9(14)5-3-4-6-13/h8-10,17-18H,3-7,13-14H2,1-2H3,(H,15,16)/t9-,10-/m0/s1 |
| InChIKey | QMYPVMKYWDWCPT-UWVGGRQHSA-N |
| XLogP | -1.01 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.16 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|