C23H14N3O2S- — CID 7481175
4-[(E)-2-(1H-benzimidazol-2-yl)-2-(1,3-benzothiazol-2-yl)ethenyl]benzoate (PubChem CID 7481175) has the molecular formula C23H14N3O2S- and a molecular weight of 396.45 g/mol. Its IUPAC name is 4-[(E)-2-(1H-benzimidazol-2-yl)-2-(1,3-benzothiazol-2-yl)ethenyl]benzoate.
| Compound Name | 4-[(E)-2-(1H-benzimidazol-2-yl)-2-(1,3-benzothiazol-2-yl)ethenyl]benzoate |
|---|---|
| PubChem CID | 7481175 |
| Molecular Formula | C23H14N3O2S- |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 4-[(E)-2-(1H-benzimidazol-2-yl)-2-(1,3-benzothiazol-2-yl)ethenyl]benzoate |
| SMILES | O=C([O-])c1ccc(/C=C(\c2nc3ccccc3[nH]2)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C23H15N3O2S/c27-23(28)15-11-9-14(10-12-15)13-16(21-24-17-5-1-2-6-18(17)25-21)22-26-19-7-3-4-8-20(19)29-22/h1-13H,(H,24,25)(H,27,28)/p-1/b16-13+ |
| InChIKey | QSMNYMDJWJLCIO-DTQAZKPQSA-M |
| XLogP | 4.12 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |