C12H11FN4O2S3 — CID 7528771
(2S)-N-carbamoyl-2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide (PubChem CID 7528771) has the molecular formula C12H11FN4O2S3 and a molecular weight of 358.45 g/mol. Its IUPAC name is (2S)-N-carbamoyl-2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide.
| Compound Name | (2S)-N-carbamoyl-2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 7528771 |
| Molecular Formula | C12H11FN4O2S3 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | (2S)-N-carbamoyl-2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
| SMILES | C[C@H](Sc1nn(-c2ccc(F)cc2)c(=S)s1)C(=O)NC(N)=O |
| InChI | InChI=1S/C12H11FN4O2S3/c1-6(9(18)15-10(14)19)21-11-16-17(12(20)22-11)8-4-2-7(13)3-5-8/h2-6H,1H3,(H3,14,15,18,19)/t6-/m0/s1 |
| InChIKey | GKSOIKHFTDCRGG-LURJTMIESA-N |
| XLogP | 2.48 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|