C14H19N3O3S2 — CID 75387293
(1-methylimidazol-2-yl)-(1-thiophen-2-ylsulfonylpiperidin-3-yl)methanol (PubChem CID 75387293) has the molecular formula C14H19N3O3S2 and a molecular weight of 341.46 g/mol. Its IUPAC name is (1-methylimidazol-2-yl)-(1-thiophen-2-ylsulfonylpiperidin-3-yl)methanol.
| Compound Name | (1-methylimidazol-2-yl)-(1-thiophen-2-ylsulfonylpiperidin-3-yl)methanol |
|---|---|
| PubChem CID | 75387293 |
| Molecular Formula | C14H19N3O3S2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | (1-methylimidazol-2-yl)-(1-thiophen-2-ylsulfonylpiperidin-3-yl)methanol |
| SMILES | Cn1ccnc1C(O)C1CCCN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C14H19N3O3S2/c1-16-8-6-15-14(16)13(18)11-4-2-7-17(10-11)22(19,20)12-5-3-9-21-12/h3,5-6,8-9,11,13,18H,2,4,7,10H2,1H3 |
| InChIKey | LTFSXDRHIRLIGA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |