C14H11NO4S2 — CID 75465152
7-(4-methoxyphenyl)-2-oxo-3,7-dihydrothiopyrano[2,3-d][1,3]thiazole-6-carboxylic acid (PubChem CID 75465152) has the molecular formula C14H11NO4S2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 7-(4-methoxyphenyl)-2-oxo-3,7-dihydrothiopyrano[2,3-d][1,3]thiazole-6-carboxylic acid.
| Compound Name | 7-(4-methoxyphenyl)-2-oxo-3,7-dihydrothiopyrano[2,3-d][1,3]thiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 75465152 |
| Molecular Formula | C14H11NO4S2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 7-(4-methoxyphenyl)-2-oxo-3,7-dihydrothiopyrano[2,3-d][1,3]thiazole-6-carboxylic acid |
| SMILES | COc1ccc(C2C(C(=O)O)=CSc3[nH]c(=O)sc32)cc1 |
| InChI | InChI=1S/C14H11NO4S2/c1-19-8-4-2-7(3-5-8)10-9(13(16)17)6-20-12-11(10)21-14(18)15-12/h2-6,10H,1H3,(H,15,18)(H,16,17) |
| InChIKey | SKMPVSUASWMDQU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|