C20H16N4O3S — CID 75468274
4-(4-methyl-2,5-dioxoimidazolidin-4-yl)-N-(4-phenyl-1,3-thiazol-2-yl)benzamide (PubChem CID 75468274) has the molecular formula C20H16N4O3S and a molecular weight of 392.44 g/mol. Its IUPAC name is 4-(4-methyl-2,5-dioxoimidazolidin-4-yl)-N-(4-phenyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-(4-methyl-2,5-dioxoimidazolidin-4-yl)-N-(4-phenyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 75468274 |
| Molecular Formula | C20H16N4O3S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 4-(4-methyl-2,5-dioxoimidazolidin-4-yl)-N-(4-phenyl-1,3-thiazol-2-yl)benzamide |
| SMILES | CC1(c2ccc(C(=O)Nc3nc(-c4ccccc4)cs3)cc2)NC(=O)NC1=O |
| InChI | InChI=1S/C20H16N4O3S/c1-20(17(26)23-18(27)24-20)14-9-7-13(8-10-14)16(25)22-19-21-15(11-28-19)12-5-3-2-4-6-12/h2-11H,1H3,(H,21,22,25)(H2,23,24,26,27) |
| InChIKey | XEZLDBVQZGSQDK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|