C11H7F3N2O3S2 — CID 75521559
N-thiophen-2-ylsulfonyl-3-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 75521559) has the molecular formula C11H7F3N2O3S2 and a molecular weight of 336.32 g/mol. Its IUPAC name is N-thiophen-2-ylsulfonyl-3-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-thiophen-2-ylsulfonyl-3-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 75521559 |
| Molecular Formula | C11H7F3N2O3S2 |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | N-thiophen-2-ylsulfonyl-3-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1cccs1)c1ncccc1C(F)(F)F |
| InChI | InChI=1S/C11H7F3N2O3S2/c12-11(13,14)7-3-1-5-15-9(7)10(17)16-21(18,19)8-4-2-6-20-8/h1-6H,(H,16,17) |
| InChIKey | FQHYXDBESFYBHU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |