C19H20FN3OS — CID 75546524
2-[(4-fluorophenyl)methylsulfanyl]-7-phenyl-1,2,3,4a,5,6,7,7a-octahydropyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 75546524) has the molecular formula C19H20FN3OS and a molecular weight of 357.45 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylsulfanyl]-7-phenyl-1,2,3,4a,5,6,7,7a-octahydropyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[(4-fluorophenyl)methylsulfanyl]-7-phenyl-1,2,3,4a,5,6,7,7a-octahydropyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 75546524 |
| Molecular Formula | C19H20FN3OS |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 2-[(4-fluorophenyl)methylsulfanyl]-7-phenyl-1,2,3,4a,5,6,7,7a-octahydropyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | O=C1NC(SCc2ccc(F)cc2)NC2C1NCC2c1ccccc1 |
| InChI | InChI=1S/C19H20FN3OS/c20-14-8-6-12(7-9-14)11-25-19-22-16-15(13-4-2-1-3-5-13)10-21-17(16)18(24)23-19/h1-9,15-17,19,21-22H,10-11H2,(H,23,24) |
| InChIKey | JHZQVIYPGBDYLP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |