C36H28Cl2N2O2 — CID 75587025
1,3-dibenzyl-4,5-bis(4-chlorophenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate (PubChem CID 75587025) has the molecular formula C36H28Cl2N2O2 and a molecular weight of 591.54 g/mol. Its IUPAC name is 1,3-dibenzyl-4,5-bis(4-chlorophenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate.
| Compound Name | 1,3-dibenzyl-4,5-bis(4-chlorophenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate |
|---|---|
| PubChem CID | 75587025 |
| Molecular Formula | C36H28Cl2N2O2 |
| Molecular Weight | 591.54 g/mol |
| Exact Mass | 590.15 |
| IUPAC Name | 1,3-dibenzyl-4,5-bis(4-chlorophenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate |
| SMILES | O=C([O-])C1(c2ccc(Cl)cc2)C(c2ccc(Cl)cc2)[N+](Cc2ccccc2)=C(c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C36H28Cl2N2O2/c37-31-20-16-28(17-21-31)33-36(35(41)42,30-18-22-32(38)23-19-30)40(25-27-12-6-2-7-13-27)34(29-14-8-3-9-15-29)39(33)24-26-10-4-1-5-11-26/h1-23,33H,24-25H2 |
| InChIKey | OJVFWDMFFHJKGT-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.54 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|