C30H26Cl4N2O2 — CID 139113946
(4S,5S)-3-benzyl-2,4,5-triphenyl-1,4-dihydroimidazol-3-ium-5-carboxylic acid;chloroform;chloride (PubChem CID 139113946) has the molecular formula C30H26Cl4N2O2 and a molecular weight of 588.36 g/mol. Its IUPAC name is (4S,5S)-3-benzyl-2,4,5-triphenyl-1,4-dihydroimidazol-3-ium-5-carboxylic acid;chloroform;chloride.
| Compound Name | (4S,5S)-3-benzyl-2,4,5-triphenyl-1,4-dihydroimidazol-3-ium-5-carboxylic acid;chloroform;chloride |
|---|---|
| PubChem CID | 139113946 |
| Molecular Formula | C30H26Cl4N2O2 |
| Molecular Weight | 588.36 g/mol |
| Exact Mass | 586.07 |
| IUPAC Name | (4S,5S)-3-benzyl-2,4,5-triphenyl-1,4-dihydroimidazol-3-ium-5-carboxylic acid;chloroform;chloride |
| SMILES | ClC(Cl)Cl.O=C(O)[C@@]1(c2ccccc2)NC(c2ccccc2)=[N+](Cc2ccccc2)[C@H]1c1ccccc1.[Cl-] |
| InChI | InChI=1S/C29H24N2O2.CHCl3.ClH/c32-28(33)29(25-19-11-4-12-20-25)26(23-15-7-2-8-16-23)31(21-22-13-5-1-6-14-22)27(30-29)24-17-9-3-10-18-24;2-1(3)4;/h1-20,26H,21H2,(H,32,33);1H;1H/t26-,29-;;/m0../s1 |
| InChIKey | YWZASIGNFYMZON-YYURLFHOSA-N |
| XLogP | 3.96 |
| TPSA | 52.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|