C17H16N2O5S — CID 7632097
2-(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)-1-(5-nitrothiophen-2-yl)ethanone (PubChem CID 7632097) has the molecular formula C17H16N2O5S and a molecular weight of 360.39 g/mol. Its IUPAC name is 2-(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)-1-(5-nitrothiophen-2-yl)ethanone.
| Compound Name | 2-(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)-1-(5-nitrothiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 7632097 |
| Molecular Formula | C17H16N2O5S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 2-(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)-1-(5-nitrothiophen-2-yl)ethanone |
| SMILES | COc1cc2c(cc1OC)C(CC(=O)c1ccc([N+](=O)[O-])s1)=NCC2 |
| InChI | InChI=1S/C17H16N2O5S/c1-23-14-7-10-5-6-18-12(11(10)8-15(14)24-2)9-13(20)16-3-4-17(25-16)19(21)22/h3-4,7-8H,5-6,9H2,1-2H3 |
| InChIKey | ZEKONKQXDBAOAI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 91.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|