C41H43N3O4 — CID 76590069
(5-methyl-2-propan-2-ylcyclohexyl) 2-[[3-ethyl-4-oxo-5-[[4-(N-phenylanilino)phenyl]methylidene]-1,3-oxazolidin-2-ylidene]amino]benzoate (PubChem CID 76590069) has the molecular formula C41H43N3O4 and a molecular weight of 641.81 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-[[3-ethyl-4-oxo-5-[[4-(N-phenylanilino)phenyl]methylidene]-1,3-oxazolidin-2-ylidene]amino]benzoate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-[[3-ethyl-4-oxo-5-[[4-(N-phenylanilino)phenyl]methylidene]-1,3-oxazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 76590069 |
| Molecular Formula | C41H43N3O4 |
| Molecular Weight | 641.81 g/mol |
| Exact Mass | 641.33 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-[[3-ethyl-4-oxo-5-[[4-(N-phenylanilino)phenyl]methylidene]-1,3-oxazolidin-2-ylidene]amino]benzoate |
| SMILES | CCN1C(=O)C(=Cc2ccc(N(c3ccccc3)c3ccccc3)cc2)O/C1=N/c1ccccc1C(=O)OC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C41H43N3O4/c1-5-43-39(45)38(27-30-21-23-33(24-22-30)44(31-14-8-6-9-15-31)32-16-10-7-11-17-32)48-41(43)42-36-19-13-12-18-35(36)40(46)47-37-26-29(4)20-25-34(37)28(2)3/h6-19,21-24,27-29,34,37H,5,20,25-26H2,1-4H3/b38-27?,42-41+ |
| InChIKey | NAXVCCNNTCCQCK-TYJYESICSA-N |
| XLogP | 9.68 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.81 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|