C29H45N2S2+ — CID 76662111
3-heptyl-2-[7-(3-heptyl-4-methyl-1,3-thiazol-3-ium-2-yl)hepta-2,4,6-trienylidene]-4-methyl-1,3-thiazole (PubChem CID 76662111) has the molecular formula C29H45N2S2+ and a molecular weight of 485.83 g/mol. Its IUPAC name is 3-heptyl-2-[7-(3-heptyl-4-methyl-1,3-thiazol-3-ium-2-yl)hepta-2,4,6-trienylidene]-4-methyl-1,3-thiazole.
| Compound Name | 3-heptyl-2-[7-(3-heptyl-4-methyl-1,3-thiazol-3-ium-2-yl)hepta-2,4,6-trienylidene]-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 76662111 |
| Molecular Formula | C29H45N2S2+ |
| Molecular Weight | 485.83 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | 3-heptyl-2-[7-(3-heptyl-4-methyl-1,3-thiazol-3-ium-2-yl)hepta-2,4,6-trienylidene]-4-methyl-1,3-thiazole |
| SMILES | CCCCCCCN1C(C)=CSC1=CC=CC=CC=Cc1scc(C)[n+]1CCCCCCC |
| InChI | InChI=1S/C29H45N2S2/c1-5-7-9-14-18-22-30-26(3)24-32-28(30)20-16-12-11-13-17-21-29-31(27(4)25-33-29)23-19-15-10-8-6-2/h11-13,16-17,20-21,24-25H,5-10,14-15,18-19,22-23H2,1-4H3/q+1 |
| InChIKey | BGPHJKIGOQDABE-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.83 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|