C41H67N3S3+2 — CID 75233154
2-[3,5-bis(4-methyl-3-octyl-1,3-thiazol-3-ium-2-yl)penta-2,4-dienylidene]-4-methyl-3-octyl-1,3-thiazole (PubChem CID 75233154) has the molecular formula C41H67N3S3+2 and a molecular weight of 698.21 g/mol. Its IUPAC name is 2-[3,5-bis(4-methyl-3-octyl-1,3-thiazol-3-ium-2-yl)penta-2,4-dienylidene]-4-methyl-3-octyl-1,3-thiazole.
| Compound Name | 2-[3,5-bis(4-methyl-3-octyl-1,3-thiazol-3-ium-2-yl)penta-2,4-dienylidene]-4-methyl-3-octyl-1,3-thiazole |
|---|---|
| PubChem CID | 75233154 |
| Molecular Formula | C41H67N3S3+2 |
| Molecular Weight | 698.21 g/mol |
| Exact Mass | 697.45 |
| IUPAC Name | 2-[3,5-bis(4-methyl-3-octyl-1,3-thiazol-3-ium-2-yl)penta-2,4-dienylidene]-4-methyl-3-octyl-1,3-thiazole |
| SMILES | CCCCCCCCN1C(C)=CSC1=CC=C(C=Cc1scc(C)[n+]1CCCCCCCC)c1scc(C)[n+]1CCCCCCCC |
| InChI | InChI=1S/C41H67N3S3/c1-7-10-13-16-19-22-29-42-35(4)32-45-39(42)27-25-38(41-44(37(6)34-47-41)31-24-21-18-15-12-9-3)26-28-40-43(36(5)33-46-40)30-23-20-17-14-11-8-2/h25-28,32-34H,7-24,29-31H2,1-6H3/q+2 |
| InChIKey | OVMMGMSXGDAHIT-UHFFFAOYSA-N |
| XLogP | 12.93 |
| TPSA | 11.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.21 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|